C10H14ClNO2 — CID 142794565
2-(4-chlorophenyl)-N,N-dimethoxyethanamine (PubChem CID 142794565) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-dimethoxyethanamine.
| Compound Name | 2-(4-chlorophenyl)-N,N-dimethoxyethanamine |
|---|---|
| PubChem CID | 142794565 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-dimethoxyethanamine |
| SMILES | CON(CCc1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C10H14ClNO2/c1-13-12(14-2)8-7-9-3-5-10(11)6-4-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | RBGDLVLVBWYHAJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|