C19H25FN4O2 — CID 142794917
1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-(dimethylamino)propan-2-ol (PubChem CID 142794917) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-(dimethylamino)propan-2-ol.
| Compound Name | 1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 142794917 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-(dimethylamino)propan-2-ol |
| SMILES | CN(C)CC(O)COc1ccc(C2CC(c3cnc(N)cn3)C2)cc1F |
| InChI | InChI=1S/C19H25FN4O2/c1-24(2)10-15(25)11-26-18-4-3-12(7-16(18)20)13-5-14(6-13)17-8-23-19(21)9-22-17/h3-4,7-9,13-15,25H,5-6,10-11H2,1-2H3,(H2,21,23) |
| InChIKey | SVILUJPRZIOECG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |