C21H28FN5O2 — CID 142794925
1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-piperazin-1-ylpropan-2-ol (PubChem CID 142794925) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-piperazin-1-ylpropan-2-ol.
| Compound Name | 1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-piperazin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 142794925 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]-3-piperazin-1-ylpropan-2-ol |
| SMILES | Nc1cnc(C2CC(c3ccc(OCC(O)CN4CCNCC4)c(F)c3)C2)cn1 |
| InChI | InChI=1S/C21H28FN5O2/c22-18-9-14(15-7-16(8-15)19-10-26-21(23)11-25-19)1-2-20(18)29-13-17(28)12-27-5-3-24-4-6-27/h1-2,9-11,15-17,24,28H,3-8,12-13H2,(H2,23,26) |
| InChIKey | RCVGPWQHGKQKNO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |