C23H22FN3O3 — CID 142794987
4-[2-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]ethyl]benzoic acid (PubChem CID 142794987) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-[2-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 142794987 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[2-[4-[3-(5-aminopyrazin-2-yl)cyclobutyl]-2-fluorophenoxy]ethyl]benzoic acid |
| SMILES | Nc1cnc(C2CC(c3ccc(OCCc4ccc(C(=O)O)cc4)c(F)c3)C2)cn1 |
| InChI | InChI=1S/C23H22FN3O3/c24-19-11-16(17-9-18(10-17)20-12-27-22(25)13-26-20)5-6-21(19)30-8-7-14-1-3-15(4-2-14)23(28)29/h1-6,11-13,17-18H,7-10H2,(H2,25,27)(H,28,29) |
| InChIKey | ACJGCOKAXIGQGP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |