About 2,4-dichloro-2,5-dihydrothiophene
2,4-dichloro-2,5-dihydrothiophene (PubChem CID 142795797) has the molecular formula C4H4Cl2S
and a molecular weight of 155.05 g/mol. Its IUPAC name is 2,4-dichloro-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 2,4-dichloro-2,5-dihydrothiophene |
| PubChem CID | 142795797 |
| Molecular Formula | C4H4Cl2S |
| Molecular Weight | 155.05 g/mol |
| Exact Mass | 153.94 |
| IUPAC Name | 2,4-dichloro-2,5-dihydrothiophene |
| SMILES | ClC1=CC(Cl)SC1 |
| InChI | InChI=1S/C4H4Cl2S/c5-3-1-4(6)7-2-3/h1,4H,2H2 |
| InChIKey | CDELZUMSNKFIDX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.05 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-2,5-dihydrothiophene?
The IUPAC name of 2,4-dichloro-2,5-dihydrothiophene (CID 142795797) is 2,4-dichloro-2,5-dihydrothiophene.
What is the SMILES notation for 2,4-dichloro-2,5-dihydrothiophene?
The canonical SMILES for 2,4-dichloro-2,5-dihydrothiophene is ClC1=CC(Cl)SC1.
What is the InChIKey of 2,4-dichloro-2,5-dihydrothiophene?
The InChIKey is CDELZUMSNKFIDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4Cl2S/c5-3-1-4(6)7-2-3/h1,4H,2H2.
What are the key properties of 2,4-dichloro-2,5-dihydrothiophene?
2,4-dichloro-2,5-dihydrothiophene has a molecular weight of 155.05 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-2,5-dihydrothiophene is sourced from PubChem (CID 142795797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).