C18H30N4O2S — CID 142795812
5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxamide (PubChem CID 142795812) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxamide.
| Compound Name | 5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 142795812 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxamide |
| SMILES | CCN(c1sc(N2CCN(C)CC2)c(C(N)=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C18H30N4O2S/c1-4-22(14-5-11-24-12-6-14)17-13(2)15(16(19)23)18(25-17)21-9-7-20(3)8-10-21/h14H,4-12H2,1-3H3,(H2,19,23) |
| InChIKey | IIDNPRBGCOGDDU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |