About 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole
3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole (PubChem CID 142795938) has the molecular formula C15H18ClN
and a molecular weight of 247.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole |
| PubChem CID | 142795938 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole |
| SMILES | CC1=CN(C2CCC2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClN/c1-11-9-17(14-3-2-4-14)10-15(11)12-5-7-13(16)8-6-12/h5-9,14-15H,2-4,10H2,1H3 |
| InChIKey | WLVURKUTRDUJGU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole?
The IUPAC name of 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole (CID 142795938) is 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole.
What is the SMILES notation for 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole?
The canonical SMILES for 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole is CC1=CN(C2CCC2)CC1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole?
The InChIKey is WLVURKUTRDUJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN/c1-11-9-17(14-3-2-4-14)10-15(11)12-5-7-13(16)8-6-12/h5-9,14-15H,2-4,10H2,1H3.
What are the key properties of 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole?
3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole has a molecular weight of 247.77 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-cyclobutyl-4-methyl-2,3-dihydropyrrole is sourced from PubChem (CID 142795938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).