C11H23N3O6S — CID 142796497
(4S,5S)-2,5,7-triamino-2,7-bis(hydroxymethyl)-4-methyl-4-sulfanyloctanedioic acid (PubChem CID 142796497) has the molecular formula C11H23N3O6S and a molecular weight of 325.39 g/mol. Its IUPAC name is (4S,5S)-2,5,7-triamino-2,7-bis(hydroxymethyl)-4-methyl-4-sulfanyloctanedioic acid.
| Compound Name | (4S,5S)-2,5,7-triamino-2,7-bis(hydroxymethyl)-4-methyl-4-sulfanyloctanedioic acid |
|---|---|
| PubChem CID | 142796497 |
| Molecular Formula | C11H23N3O6S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (4S,5S)-2,5,7-triamino-2,7-bis(hydroxymethyl)-4-methyl-4-sulfanyloctanedioic acid |
| SMILES | C[C@](S)(CC(N)(CO)C(=O)O)[C@@H](N)CC(N)(CO)C(=O)O |
| InChI | InChI=1S/C11H23N3O6S/c1-9(21,3-11(14,5-16)8(19)20)6(12)2-10(13,4-15)7(17)18/h6,15-16,21H,2-5,12-14H2,1H3,(H,17,18)(H,19,20)/t6-,9-,10?,11?/m0/s1 |
| InChIKey | XTKQKIURLZTFMY-DLEKDPJASA-N |
| XLogP | -2.67 |
| TPSA | 193.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|