(5-chloro-2-methoxycarbonylphenoxy)boronic acid

C8H8BClO5 — CID 142796908

IUPAC(5-chloro-2-methoxycarbonylphenoxy)boronic acid
SMILESCOC(=O)c1ccc(Cl)cc1OB(O)O
InChIInChI=1S/C8H8BClO5/c1-14-8(11)6-3-2-5(10)4-7(6)15-9(12)13/h2-4,12-13H,1H3
InChIKeyAJEWLBWPIAVNDR-UHFFFAOYSA-N
MW230.41 g/mol
LogP0.47
Rot. Bonds3

About (5-chloro-2-methoxycarbonylphenoxy)boronic acid

(5-chloro-2-methoxycarbonylphenoxy)boronic acid (PubChem CID 142796908) has the molecular formula C8H8BClO5 and a molecular weight of 230.41 g/mol. Its IUPAC name is (5-chloro-2-methoxycarbonylphenoxy)boronic acid.

Molecular Properties

Compound Name(5-chloro-2-methoxycarbonylphenoxy)boronic acid
PubChem CID142796908
Molecular FormulaC8H8BClO5
Molecular Weight230.41 g/mol
Exact Mass230.02
IUPAC Name(5-chloro-2-methoxycarbonylphenoxy)boronic acid
SMILESCOC(=O)c1ccc(Cl)cc1OB(O)O
InChIInChI=1S/C8H8BClO5/c1-14-8(11)6-3-2-5(10)4-7(6)15-9(12)13/h2-4,12-13H,1H3
InChIKeyAJEWLBWPIAVNDR-UHFFFAOYSA-N
XLogP0.47
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.41
LogP ≤ 50.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-chloro-2-methoxycarbonylphenoxy)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-chloro-2-methoxycarbonylphenoxy)boronic acid?
The IUPAC name of (5-chloro-2-methoxycarbonylphenoxy)boronic acid (CID 142796908) is (5-chloro-2-methoxycarbonylphenoxy)boronic acid.
What is the SMILES notation for (5-chloro-2-methoxycarbonylphenoxy)boronic acid?
The canonical SMILES for (5-chloro-2-methoxycarbonylphenoxy)boronic acid is COC(=O)c1ccc(Cl)cc1OB(O)O.
What is the InChIKey of (5-chloro-2-methoxycarbonylphenoxy)boronic acid?
The InChIKey is AJEWLBWPIAVNDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BClO5/c1-14-8(11)6-3-2-5(10)4-7(6)15-9(12)13/h2-4,12-13H,1H3.
What are the key properties of (5-chloro-2-methoxycarbonylphenoxy)boronic acid?
(5-chloro-2-methoxycarbonylphenoxy)boronic acid has a molecular weight of 230.41 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-methoxycarbonylphenoxy)boronic acid is sourced from PubChem (CID 142796908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).