C14H13ClF3NO4S — CID 142797383
[(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-yl]oxy methanesulfonate (PubChem CID 142797383) has the molecular formula C14H13ClF3NO4S and a molecular weight of 383.78 g/mol. Its IUPAC name is [(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-yl]oxy methanesulfonate.
| Compound Name | [(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-yl]oxy methanesulfonate |
|---|---|
| PubChem CID | 142797383 |
| Molecular Formula | C14H13ClF3NO4S |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | [(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-yl]oxy methanesulfonate |
| SMILES | CS(=O)(=O)OO[C@@](C#CC1CC1)(c1cc(Cl)ccc1N)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3NO4S/c1-24(20,21)23-22-13(14(16,17)18,7-6-9-2-3-9)11-8-10(15)4-5-12(11)19/h4-5,8-9H,2-3,19H2,1H3/t13-/m0/s1 |
| InChIKey | MUELQUMGEXFTPO-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|