C20H18Cl2F5N3O — CID 142797562
N-[1,1-dichloro-2-(4,4-difluorocyclohexyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide (PubChem CID 142797562) has the molecular formula C20H18Cl2F5N3O and a molecular weight of 482.28 g/mol. Its IUPAC name is N-[1,1-dichloro-2-(4,4-difluorocyclohexyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide.
| Compound Name | N-[1,1-dichloro-2-(4,4-difluorocyclohexyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 142797562 |
| Molecular Formula | C20H18Cl2F5N3O |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[1,1-dichloro-2-(4,4-difluorocyclohexyl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]benzamide |
| SMILES | O=C(NC(Cl)(Cl)C(c1cnc(C(F)(F)F)nc1)C1CCC(F)(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H18Cl2F5N3O/c21-19(22,30-16(31)13-4-2-1-3-5-13)15(12-6-8-18(23,24)9-7-12)14-10-28-17(29-11-14)20(25,26)27/h1-5,10-12,15H,6-9H2,(H,30,31) |
| InChIKey | BZZMTWYLQVQBCY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|