C13H10N4O — CID 142798100
(1Z,12Z)-3,5,8,11-tetrazabicyclo[11.4.0]heptadeca-1,3,5,7,10,12,14,16-octaen-9-one (PubChem CID 142798100) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is (1Z,12Z)-3,5,8,11-tetrazabicyclo[11.4.0]heptadeca-1,3,5,7,10,12,14,16-octaen-9-one.
| Compound Name | (1Z,12Z)-3,5,8,11-tetrazabicyclo[11.4.0]heptadeca-1,3,5,7,10,12,14,16-octaen-9-one |
|---|---|
| PubChem CID | 142798100 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (1Z,12Z)-3,5,8,11-tetrazabicyclo[11.4.0]heptadeca-1,3,5,7,10,12,14,16-octaen-9-one |
| SMILES | O=C1/C=N\C=c2\cccc\c2=C\N=C\N=C\C=N/1 |
| InChI | InChI=1S/C13H10N4O/c18-13-9-15-7-11-3-1-2-4-12(11)8-16-10-14-5-6-17-13/h1-10H/b11-7-,12-8-,14-5+,15-9-,16-10+,17-6- |
| InChIKey | KFFSUSNOAAZLAY-YMOHHNOWSA-N |
| XLogP | -0.06 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |