About [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate
[2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate (PubChem CID 142798141) has the molecular formula C13H12F6O4
and a molecular weight of 346.22 g/mol. Its IUPAC name is [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate |
| PubChem CID | 142798141 |
| Molecular Formula | C13H12F6O4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate |
| SMILES | O=C(OC1C=CCC(C(F)(F)F)O1)C1C=CCC(C(F)(F)F)O1 |
| InChI | InChI=1S/C13H12F6O4/c14-12(15,16)8-4-1-3-7(21-8)11(20)23-10-6-2-5-9(22-10)13(17,18)19/h1-3,6-10H,4-5H2 |
| InChIKey | RSEVLGYPPHVGSO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate?
The IUPAC name of [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate (CID 142798141) is [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate.
What is the SMILES notation for [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate?
The canonical SMILES for [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate is O=C(OC1C=CCC(C(F)(F)F)O1)C1C=CCC(C(F)(F)F)O1.
What is the InChIKey of [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate?
The InChIKey is RSEVLGYPPHVGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F6O4/c14-12(15,16)8-4-1-3-7(21-8)11(20)23-10-6-2-5-9(22-10)13(17,18)19/h1-3,6-10H,4-5H2.
What are the key properties of [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate?
[2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate has a molecular weight of 346.22 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-yl] 2-(trifluoromethyl)-3,6-dihydro-2H-pyran-6-carboxylate is sourced from PubChem (CID 142798141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).