About [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate
[(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate (PubChem CID 142798534) has the molecular formula C8H11F3N2O3
and a molecular weight of 240.18 g/mol. Its IUPAC name is [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate |
| PubChem CID | 142798534 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate |
| SMILES | O=C(OCNC(=O)C(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C8H11F3N2O3/c9-8(10,11)6(14)12-5-16-7(15)13-3-1-2-4-13/h1-5H2,(H,12,14) |
| InChIKey | MCODZUDIZIFPOV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate?
The IUPAC name of [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate (CID 142798534) is [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate.
What is the SMILES notation for [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate?
The canonical SMILES for [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate is O=C(OCNC(=O)C(F)(F)F)N1CCCC1.
What is the InChIKey of [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate?
The InChIKey is MCODZUDIZIFPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O3/c9-8(10,11)6(14)12-5-16-7(15)13-3-1-2-4-13/h1-5H2,(H,12,14).
What are the key properties of [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate?
[(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate has a molecular weight of 240.18 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,2,2-trifluoroacetyl)amino]methyl pyrrolidine-1-carboxylate is sourced from PubChem (CID 142798534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).