C22H25N5O3 — CID 142798696
4-[[1-(3,4-dimethoxyphenyl)piperidin-3-yl]amino]quinazoline-8-carboxamide (PubChem CID 142798696) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[[1-(3,4-dimethoxyphenyl)piperidin-3-yl]amino]quinazoline-8-carboxamide.
| Compound Name | 4-[[1-(3,4-dimethoxyphenyl)piperidin-3-yl]amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 142798696 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-[[1-(3,4-dimethoxyphenyl)piperidin-3-yl]amino]quinazoline-8-carboxamide |
| SMILES | COc1ccc(N2CCCC(Nc3ncnc4c(C(N)=O)cccc34)C2)cc1OC |
| InChI | InChI=1S/C22H25N5O3/c1-29-18-9-8-15(11-19(18)30-2)27-10-4-5-14(12-27)26-22-17-7-3-6-16(21(23)28)20(17)24-13-25-22/h3,6-9,11,13-14H,4-5,10,12H2,1-2H3,(H2,23,28)(H,24,25,26) |
| InChIKey | JOTBSSYQBUWYIQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|