About 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone
1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 142799237) has the molecular formula C13H17ClO2
and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone |
| PubChem CID | 142799237 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | C=CC1=CC(Cl)=CC(C)(C(C)=O)C1OCC |
| InChI | InChI=1S/C13H17ClO2/c1-5-10-7-11(14)8-13(4,9(3)15)12(10)16-6-2/h5,7-8,12H,1,6H2,2-4H3 |
| InChIKey | MXOVZQNZOBEDNV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone?
The IUPAC name of 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone (CID 142799237) is 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone.
What is the SMILES notation for 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone?
The canonical SMILES for 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone is C=CC1=CC(Cl)=CC(C)(C(C)=O)C1OCC.
What is the InChIKey of 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone?
The InChIKey is MXOVZQNZOBEDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO2/c1-5-10-7-11(14)8-13(4,9(3)15)12(10)16-6-2/h5,7-8,12H,1,6H2,2-4H3.
What are the key properties of 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone?
1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone has a molecular weight of 240.73 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-5-ethenyl-6-ethoxy-1-methylcyclohexa-2,4-dien-1-yl)ethanone is sourced from PubChem (CID 142799237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).