About (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane
(7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane (PubChem CID 142800310) has the molecular formula C9H18F2N2
and a molecular weight of 192.25 g/mol. Its IUPAC name is (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane.
Molecular Properties
| Compound Name | (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane |
| PubChem CID | 142800310 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane |
| SMILES | CC[C@H]1CCNCCN1CC(F)F |
| InChI | InChI=1S/C9H18F2N2/c1-2-8-3-4-12-5-6-13(8)7-9(10)11/h8-9,12H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | XBWFPNWJAQYJTM-QMMMGPOBSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane?
The IUPAC name of (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane (CID 142800310) is (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane.
What is the SMILES notation for (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane?
The canonical SMILES for (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane is CC[C@H]1CCNCCN1CC(F)F.
What is the InChIKey of (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane?
The InChIKey is XBWFPNWJAQYJTM-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H18F2N2/c1-2-8-3-4-12-5-6-13(8)7-9(10)11/h8-9,12H,2-7H2,1H3/t8-/m0/s1.
What are the key properties of (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane?
(7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane has a molecular weight of 192.25 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane is sourced from PubChem (CID 142800310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).