C9H17N3 — CID 142800844
3-N-pentyl-2H-pyrrole-3,5-diamine (PubChem CID 142800844) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3-N-pentyl-2H-pyrrole-3,5-diamine.
| Compound Name | 3-N-pentyl-2H-pyrrole-3,5-diamine |
|---|---|
| PubChem CID | 142800844 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3-N-pentyl-2H-pyrrole-3,5-diamine |
| SMILES | CCCCCNC1=CC(N)=NC1 |
| InChI | InChI=1S/C9H17N3/c1-2-3-4-5-11-8-6-9(10)12-7-8/h6,11H,2-5,7H2,1H3,(H2,10,12) |
| InChIKey | PDQNAOWZCMHSSW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|