C16H13Cl2FN4O — CID 142801646
3-(2,4-dichlorophenyl)-6-fluoro-2-(2-hydrazinylethyl)quinazolin-4-one (PubChem CID 142801646) has the molecular formula C16H13Cl2FN4O and a molecular weight of 367.21 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-fluoro-2-(2-hydrazinylethyl)quinazolin-4-one.
| Compound Name | 3-(2,4-dichlorophenyl)-6-fluoro-2-(2-hydrazinylethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 142801646 |
| Molecular Formula | C16H13Cl2FN4O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-fluoro-2-(2-hydrazinylethyl)quinazolin-4-one |
| SMILES | NNCCc1nc2ccc(F)cc2c(=O)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FN4O/c17-9-1-4-14(12(18)7-9)23-15(5-6-21-20)22-13-3-2-10(19)8-11(13)16(23)24/h1-4,7-8,21H,5-6,20H2 |
| InChIKey | ZTYPWALDWJSJKE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|