About 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine
2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine (PubChem CID 142802248) has the molecular formula C7H11F2N
and a molecular weight of 147.17 g/mol. Its IUPAC name is 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine.
Molecular Properties
| Compound Name | 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine |
| PubChem CID | 142802248 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine |
| SMILES | CC(F)=C=C(F)CN(C)C |
| InChI | InChI=1S/C7H11F2N/c1-6(8)4-7(9)5-10(2)3/h5H2,1-3H3 |
| InChIKey | OWGAVHJITPLJBN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine?
The IUPAC name of 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine (CID 142802248) is 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine.
What is the SMILES notation for 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine?
The canonical SMILES for 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine is CC(F)=C=C(F)CN(C)C.
What is the InChIKey of 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine?
The InChIKey is OWGAVHJITPLJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N/c1-6(8)4-7(9)5-10(2)3/h5H2,1-3H3.
What are the key properties of 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine?
2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine has a molecular weight of 147.17 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-N,N-dimethylpenta-2,3-dien-1-amine is sourced from PubChem (CID 142802248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).