About (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine
(E)-2-fluoro-N,N-dimethylbut-2-en-1-amine (PubChem CID 142802251) has the molecular formula C6H12FN
and a molecular weight of 117.17 g/mol. Its IUPAC name is (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine |
| PubChem CID | 142802251 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine |
| SMILES | C/C=C(/F)CN(C)C |
| InChI | InChI=1S/C6H12FN/c1-4-6(7)5-8(2)3/h4H,5H2,1-3H3/b6-4+ |
| InChIKey | AJDJOUSWEPRCNK-GQCTYLIASA-N |
| XLogP | 1.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine?
The IUPAC name of (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine (CID 142802251) is (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine.
What is the SMILES notation for (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine?
The canonical SMILES for (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine is C/C=C(/F)CN(C)C.
What is the InChIKey of (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine?
The InChIKey is AJDJOUSWEPRCNK-GQCTYLIASA-N. The full InChI is InChI=1S/C6H12FN/c1-4-6(7)5-8(2)3/h4H,5H2,1-3H3/b6-4+.
What are the key properties of (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine?
(E)-2-fluoro-N,N-dimethylbut-2-en-1-amine has a molecular weight of 117.17 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-fluoro-N,N-dimethylbut-2-en-1-amine is sourced from PubChem (CID 142802251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).