About 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol
2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol (PubChem CID 142802698) has the molecular formula C22H41F2NO
and a molecular weight of 373.57 g/mol. Its IUPAC name is 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol |
| PubChem CID | 142802698 |
| Molecular Formula | C22H41F2NO |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol |
| SMILES | CCCC(C)C1CC(C)CC(O)C1CCCNCC(F)CC/C=C(\C)F |
| InChI | InChI=1S/C22H41F2NO/c1-5-8-17(3)21-13-16(2)14-22(26)20(21)11-7-12-25-15-19(24)10-6-9-18(4)23/h9,16-17,19-22,25-26H,5-8,10-15H2,1-4H3/b18-9+ |
| InChIKey | XNJQEYJUJMSOEZ-GIJQJNRQSA-N |
| XLogP | 5.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol?
The IUPAC name of 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol (CID 142802698) is 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol.
What is the SMILES notation for 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol?
The canonical SMILES for 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol is CCCC(C)C1CC(C)CC(O)C1CCCNCC(F)CC/C=C(\C)F.
What is the InChIKey of 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol?
The InChIKey is XNJQEYJUJMSOEZ-GIJQJNRQSA-N. The full InChI is InChI=1S/C22H41F2NO/c1-5-8-17(3)21-13-16(2)14-22(26)20(21)11-7-12-25-15-19(24)10-6-9-18(4)23/h9,16-17,19-22,25-26H,5-8,10-15H2,1-4H3/b18-9+.
What are the key properties of 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol?
2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol has a molecular weight of 373.57 g/mol, XLogP of 5.81, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[(E)-2,6-difluorohept-5-enyl]amino]propyl]-5-methyl-3-pentan-2-ylcyclohexan-1-ol is sourced from PubChem (CID 142802698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).