C26H19Cl3N4O — CID 142802824
7-(3-azatricyclo[4.1.0.01,3]heptan-7-ylamino)-5-(2-chlorophenyl)-1-(2,6-dichlorophenyl)-1,6-naphthyridin-2-one (PubChem CID 142802824) has the molecular formula C26H19Cl3N4O and a molecular weight of 509.82 g/mol. Its IUPAC name is 7-(3-azatricyclo[4.1.0.01,3]heptan-7-ylamino)-5-(2-chlorophenyl)-1-(2,6-dichlorophenyl)-1,6-naphthyridin-2-one.
| Compound Name | 7-(3-azatricyclo[4.1.0.01,3]heptan-7-ylamino)-5-(2-chlorophenyl)-1-(2,6-dichlorophenyl)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 142802824 |
| Molecular Formula | C26H19Cl3N4O |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 7-(3-azatricyclo[4.1.0.01,3]heptan-7-ylamino)-5-(2-chlorophenyl)-1-(2,6-dichlorophenyl)-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2c(-c3ccccc3Cl)nc(NC3C4CCN5CC435)cc2n1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H19Cl3N4O/c27-17-5-2-1-4-14(17)23-15-8-9-22(34)33(24-18(28)6-3-7-19(24)29)20(15)12-21(30-23)31-25-16-10-11-32-13-26(16,25)32/h1-9,12,16,25H,10-11,13H2,(H,30,31) |
| InChIKey | ODYLJGDMCFIYBX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|