C29H31FN8S — CID 142803403
2-N-[(4-fluorophenyl)methyl]-5-N,1-dimethyl-5-N-[2-[4-[2-(methylaminosulfanyl)ethyl]anilino]pyrimidin-4-yl]benzimidazole-2,5-diamine (PubChem CID 142803403) has the molecular formula C29H31FN8S and a molecular weight of 542.69 g/mol. Its IUPAC name is 2-N-[(4-fluorophenyl)methyl]-5-N,1-dimethyl-5-N-[2-[4-[2-(methylaminosulfanyl)ethyl]anilino]pyrimidin-4-yl]benzimidazole-2,5-diamine.
| Compound Name | 2-N-[(4-fluorophenyl)methyl]-5-N,1-dimethyl-5-N-[2-[4-[2-(methylaminosulfanyl)ethyl]anilino]pyrimidin-4-yl]benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 142803403 |
| Molecular Formula | C29H31FN8S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-N-[(4-fluorophenyl)methyl]-5-N,1-dimethyl-5-N-[2-[4-[2-(methylaminosulfanyl)ethyl]anilino]pyrimidin-4-yl]benzimidazole-2,5-diamine |
| SMILES | CNSCCc1ccc(Nc2nccc(N(C)c3ccc4c(c3)nc(NCc3ccc(F)cc3)n4C)n2)cc1 |
| InChI | InChI=1S/C29H31FN8S/c1-31-39-17-15-20-6-10-23(11-7-20)34-28-32-16-14-27(36-28)37(2)24-12-13-26-25(18-24)35-29(38(26)3)33-19-21-4-8-22(30)9-5-21/h4-14,16,18,31H,15,17,19H2,1-3H3,(H,33,35)(H,32,34,36) |
| InChIKey | RSQXREQINABQGJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|