About 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine
2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine (PubChem CID 142803505) has the molecular formula C16H21ClN2O4
and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine |
| PubChem CID | 142803505 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine |
| SMILES | C=CCOc1c(Cl)cc(C=C(C=O)C=O)cc1OC.CNNC |
| InChI | InChI=1S/C14H13ClO4.C2H8N2/c1-3-4-19-14-12(15)6-10(7-13(14)18-2)5-11(8-16)9-17;1-3-4-2/h3,5-9H,1,4H2,2H3;3-4H,1-2H3 |
| InChIKey | LLPALBOUKNCRIX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine?
The IUPAC name of 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine (CID 142803505) is 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine.
What is the SMILES notation for 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine?
The canonical SMILES for 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine is C=CCOc1c(Cl)cc(C=C(C=O)C=O)cc1OC.CNNC.
What is the InChIKey of 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine?
The InChIKey is LLPALBOUKNCRIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClO4.C2H8N2/c1-3-4-19-14-12(15)6-10(7-13(14)18-2)5-11(8-16)9-17;1-3-4-2/h3,5-9H,1,4H2,2H3;3-4H,1-2H3.
What are the key properties of 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine?
2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine has a molecular weight of 340.81 g/mol, XLogP of 2.03, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]propanedial;1,2-dimethylhydrazine is sourced from PubChem (CID 142803505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).