C13H18O — CID 142804443
1,2-bis(ethenyl)-4-methylbenzene;methoxymethane (PubChem CID 142804443) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4-methylbenzene;methoxymethane.
| Compound Name | 1,2-bis(ethenyl)-4-methylbenzene;methoxymethane |
|---|---|
| PubChem CID | 142804443 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1,2-bis(ethenyl)-4-methylbenzene;methoxymethane |
| SMILES | C=Cc1ccc(C)cc1C=C.COC |
| InChI | InChI=1S/C11H12.C2H6O/c1-4-10-7-6-9(3)8-11(10)5-2;1-3-2/h4-8H,1-2H2,3H3;1-2H3 |
| InChIKey | GFQIXTWCMBMGJH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |