About ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine
ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine (PubChem CID 142804526) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine.
Molecular Properties
| Compound Name | ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine |
| PubChem CID | 142804526 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine |
| SMILES | C.CC.CC.Cc1cnc2n1CCCC=C2 |
| InChI | InChI=1S/C9H12N2.2C2H6.CH4/c1-8-7-10-9-5-3-2-4-6-11(8)9;2*1-2;/h3,5,7H,2,4,6H2,1H3;2*1-2H3;1H4 |
| InChIKey | OSBDIDJLJVHMPE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine?
The IUPAC name of ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine (CID 142804526) is ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine.
What is the SMILES notation for ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine?
The canonical SMILES for ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine is C.CC.CC.Cc1cnc2n1CCCC=C2.
What is the InChIKey of ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine?
The InChIKey is OSBDIDJLJVHMPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.2C2H6.CH4/c1-8-7-10-9-5-3-2-4-6-11(8)9;2*1-2;/h3,5,7H,2,4,6H2,1H3;2*1-2H3;1H4.
What are the key properties of ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine?
ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine has a molecular weight of 224.39 g/mol, XLogP of 4.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;3-methyl-6,7-dihydro-5H-imidazo[1,2-a]azepine is sourced from PubChem (CID 142804526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).