C19H33N — CID 142805008
ethane;1-[(3-ethyl-2-propylphenyl)methyl]-3-methylpyrrolidine (PubChem CID 142805008) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is ethane;1-[(3-ethyl-2-propylphenyl)methyl]-3-methylpyrrolidine.
| Compound Name | ethane;1-[(3-ethyl-2-propylphenyl)methyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 142805008 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | ethane;1-[(3-ethyl-2-propylphenyl)methyl]-3-methylpyrrolidine |
| SMILES | CC.CCCc1c(CC)cccc1CN1CCC(C)C1 |
| InChI | InChI=1S/C17H27N.C2H6/c1-4-7-17-15(5-2)8-6-9-16(17)13-18-11-10-14(3)12-18;1-2/h6,8-9,14H,4-5,7,10-13H2,1-3H3;1-2H3 |
| InChIKey | DZNGMWZRSGFVOE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |