C29H38N2O4S2 — CID 142805296
N-[[4-(4-cyclopropyl-2-pyridin-2-ylsulfonylphenyl)sulfonylphenyl]methyl]hexan-3-amine;ethene;molecular hydrogen (PubChem CID 142805296) has the molecular formula C29H38N2O4S2 and a molecular weight of 542.77 g/mol. Its IUPAC name is N-[[4-(4-cyclopropyl-2-pyridin-2-ylsulfonylphenyl)sulfonylphenyl]methyl]hexan-3-amine;ethene;molecular hydrogen.
| Compound Name | N-[[4-(4-cyclopropyl-2-pyridin-2-ylsulfonylphenyl)sulfonylphenyl]methyl]hexan-3-amine;ethene;molecular hydrogen |
|---|---|
| PubChem CID | 142805296 |
| Molecular Formula | C29H38N2O4S2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | N-[[4-(4-cyclopropyl-2-pyridin-2-ylsulfonylphenyl)sulfonylphenyl]methyl]hexan-3-amine;ethene;molecular hydrogen |
| SMILES | C=C.CCCC(CC)NCc1ccc(S(=O)(=O)c2ccc(C3CC3)cc2S(=O)(=O)c2ccccn2)cc1.[H][H] |
| InChI | InChI=1S/C27H32N2O4S2.C2H4.H2/c1-3-7-23(4-2)29-19-20-9-14-24(15-10-20)34(30,31)25-16-13-22(21-11-12-21)18-26(25)35(32,33)27-8-5-6-17-28-27;1-2;/h5-6,8-10,13-18,21,23,29H,3-4,7,11-12,19H2,1-2H3;1-2H2;1H |
| InChIKey | IPABDINWEPUNQM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|