C9H17NO2 — CID 142805365
ethane;4-(2-methylprop-2-enyl)-1,3-oxazolidin-2-one (PubChem CID 142805365) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is ethane;4-(2-methylprop-2-enyl)-1,3-oxazolidin-2-one.
| Compound Name | ethane;4-(2-methylprop-2-enyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142805365 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | ethane;4-(2-methylprop-2-enyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(C)CC1COC(=O)N1.CC |
| InChI | InChI=1S/C7H11NO2.C2H6/c1-5(2)3-6-4-10-7(9)8-6;1-2/h6H,1,3-4H2,2H3,(H,8,9);1-2H3 |
| InChIKey | FJBSMLYKUAXSQE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|