C25H21N3S — CID 142806416
2-(benzenecarboximidoyl)-4-N-(3-phenylphenyl)sulfanylbenzene-1,4-diamine (PubChem CID 142806416) has the molecular formula C25H21N3S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-4-N-(3-phenylphenyl)sulfanylbenzene-1,4-diamine.
| Compound Name | 2-(benzenecarboximidoyl)-4-N-(3-phenylphenyl)sulfanylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142806416 |
| Molecular Formula | C25H21N3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(benzenecarboximidoyl)-4-N-(3-phenylphenyl)sulfanylbenzene-1,4-diamine |
| SMILES | [H]/N=C(\c1ccccc1)c1cc(NSc2cccc(-c3ccccc3)c2)ccc1N |
| InChI | InChI=1S/C25H21N3S/c26-24-15-14-21(17-23(24)25(27)19-10-5-2-6-11-19)28-29-22-13-7-12-20(16-22)18-8-3-1-4-9-18/h1-17,27-28H,26H2/b27-25+ |
| InChIKey | QWFIFSMFZRSXIK-IMVLJIQESA-N |
| XLogP | 6.47 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|