N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen

C6H15NO — CID 142806903

IUPACN-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen
SMILESCNC[C@H]1CCCO1.[H][H]
InChIInChI=1S/C6H13NO.H2/c1-7-5-6-3-2-4-8-6;/h6-7H,2-5H2,1H3;1H/t6-;/m1./s1
InChIKeyUKECMZNMYVNLHY-FYZOBXCZSA-N
MW117.19 g/mol
LogP0.63
Rot. Bonds2

About N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen

N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen (PubChem CID 142806903) has the molecular formula C6H15NO and a molecular weight of 117.19 g/mol. Its IUPAC name is N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen.

Molecular Properties

Compound NameN-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen
PubChem CID142806903
Molecular FormulaC6H15NO
Molecular Weight117.19 g/mol
Exact Mass117.12
IUPAC NameN-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen
SMILESCNC[C@H]1CCCO1.[H][H]
InChIInChI=1S/C6H13NO.H2/c1-7-5-6-3-2-4-8-6;/h6-7H,2-5H2,1H3;1H/t6-;/m1./s1
InChIKeyUKECMZNMYVNLHY-FYZOBXCZSA-N
XLogP0.63
TPSA21.26 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500117.19
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen?
The IUPAC name of N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen (CID 142806903) is N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen.
What is the SMILES notation for N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen?
The canonical SMILES for N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen is CNC[C@H]1CCCO1.[H][H].
What is the InChIKey of N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen?
The InChIKey is UKECMZNMYVNLHY-FYZOBXCZSA-N. The full InChI is InChI=1S/C6H13NO.H2/c1-7-5-6-3-2-4-8-6;/h6-7H,2-5H2,1H3;1H/t6-;/m1./s1.
What are the key properties of N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen?
N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen has a molecular weight of 117.19 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(2R)-oxolan-2-yl]methanamine;molecular hydrogen is sourced from PubChem (CID 142806903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).