About N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide
N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide (PubChem CID 1428071) has the molecular formula C21H20N2O4S
and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide |
| PubChem CID | 1428071 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccs2)c(OC)cc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-26-17-13-16(23-21(25)19-9-6-10-28-19)18(27-2)12-15(17)22-20(24)11-14-7-4-3-5-8-14/h3-10,12-13H,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | MWFQAWHBNCZMRA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide?
The IUPAC name of N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide (CID 1428071) is N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide is COc1cc(NC(=O)c2cccs2)c(OC)cc1NC(=O)Cc1ccccc1.
What is the InChIKey of N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide?
The InChIKey is MWFQAWHBNCZMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4S/c1-26-17-13-16(23-21(25)19-9-6-10-28-19)18(27-2)12-15(17)22-20(24)11-14-7-4-3-5-8-14/h3-10,12-13H,11H2,1-2H3,(H,22,24)(H,23,25).
What are the key properties of N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide?
N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide has a molecular weight of 396.47 g/mol, XLogP of 4.20, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 1428071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).