C19H15FN6 — CID 142807301
3-[3-fluoro-5-(5-pyridin-2-yltetrazol-2-yl)phenyl]-N-methylaniline (PubChem CID 142807301) has the molecular formula C19H15FN6 and a molecular weight of 346.37 g/mol. Its IUPAC name is 3-[3-fluoro-5-(5-pyridin-2-yltetrazol-2-yl)phenyl]-N-methylaniline.
| Compound Name | 3-[3-fluoro-5-(5-pyridin-2-yltetrazol-2-yl)phenyl]-N-methylaniline |
|---|---|
| PubChem CID | 142807301 |
| Molecular Formula | C19H15FN6 |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-[3-fluoro-5-(5-pyridin-2-yltetrazol-2-yl)phenyl]-N-methylaniline |
| SMILES | CNc1cccc(-c2cc(F)cc(-n3nnc(-c4ccccn4)n3)c2)c1 |
| InChI | InChI=1S/C19H15FN6/c1-21-16-6-4-5-13(10-16)14-9-15(20)12-17(11-14)26-24-19(23-25-26)18-7-2-3-8-22-18/h2-12,21H,1H3 |
| InChIKey | BCFROZRMFFZPJK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |