About N-imino-1,3-thiazole-2-carboximidamide
N-imino-1,3-thiazole-2-carboximidamide (PubChem CID 142807438) has the molecular formula C4H4N4S
and a molecular weight of 140.17 g/mol. Its IUPAC name is N-imino-1,3-thiazole-2-carboximidamide.
Molecular Properties
| Compound Name | N-imino-1,3-thiazole-2-carboximidamide |
| PubChem CID | 142807438 |
| Molecular Formula | C4H4N4S |
| Molecular Weight | 140.17 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | N-imino-1,3-thiazole-2-carboximidamide |
| SMILES | [H]/N=C(\N=N\[H])c1nccs1 |
| InChI | InChI=1S/C4H4N4S/c5-3(8-6)4-7-1-2-9-4/h1-2,5-6H/b5-3-,8-6+ |
| InChIKey | RPPROTWUIDOKIX-CUKJDEOPSA-N |
| XLogP | 1.50 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-imino-1,3-thiazole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-imino-1,3-thiazole-2-carboximidamide?
The IUPAC name of N-imino-1,3-thiazole-2-carboximidamide (CID 142807438) is N-imino-1,3-thiazole-2-carboximidamide.
What is the SMILES notation for N-imino-1,3-thiazole-2-carboximidamide?
The canonical SMILES for N-imino-1,3-thiazole-2-carboximidamide is [H]/N=C(\N=N\[H])c1nccs1.
What is the InChIKey of N-imino-1,3-thiazole-2-carboximidamide?
The InChIKey is RPPROTWUIDOKIX-CUKJDEOPSA-N. The full InChI is InChI=1S/C4H4N4S/c5-3(8-6)4-7-1-2-9-4/h1-2,5-6H/b5-3-,8-6+.
What are the key properties of N-imino-1,3-thiazole-2-carboximidamide?
N-imino-1,3-thiazole-2-carboximidamide has a molecular weight of 140.17 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-imino-1,3-thiazole-2-carboximidamide is sourced from PubChem (CID 142807438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).