C27H27ClN2O2 — CID 142807524
N-[(2S)-4-(4-chlorophenyl)-3-phenylbutan-2-yl]-2-(4-cyanophenoxy)-2-methylpropanamide (PubChem CID 142807524) has the molecular formula C27H27ClN2O2 and a molecular weight of 446.98 g/mol. Its IUPAC name is N-[(2S)-4-(4-chlorophenyl)-3-phenylbutan-2-yl]-2-(4-cyanophenoxy)-2-methylpropanamide.
| Compound Name | N-[(2S)-4-(4-chlorophenyl)-3-phenylbutan-2-yl]-2-(4-cyanophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 142807524 |
| Molecular Formula | C27H27ClN2O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[(2S)-4-(4-chlorophenyl)-3-phenylbutan-2-yl]-2-(4-cyanophenoxy)-2-methylpropanamide |
| SMILES | C[C@H](NC(=O)C(C)(C)Oc1ccc(C#N)cc1)C(Cc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H27ClN2O2/c1-19(30-26(31)27(2,3)32-24-15-11-21(18-29)12-16-24)25(22-7-5-4-6-8-22)17-20-9-13-23(28)14-10-20/h4-16,19,25H,17H2,1-3H3,(H,30,31)/t19-,25?/m0/s1 |
| InChIKey | BABVSXSJKSMMIB-UBDBMELISA-N |
| XLogP | 5.90 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |