About methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate
methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate (PubChem CID 142807767) has the molecular formula C12H23NO4
and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate.
Molecular Properties
| Compound Name | methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate |
| PubChem CID | 142807767 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate |
| SMILES | CCC(CO[C@@H](NC=O)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C12H23NO4/c1-6-9(10(15)16-5)7-17-11(13-8-14)12(2,3)4/h8-9,11H,6-7H2,1-5H3,(H,13,14)/t9?,11-/m1/s1 |
| InChIKey | USPSCPBMLKAVAX-HCCKASOXSA-N |
| XLogP | 1.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate?
The IUPAC name of methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate (CID 142807767) is methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate.
What is the SMILES notation for methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate?
The canonical SMILES for methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate is CCC(CO[C@@H](NC=O)C(C)(C)C)C(=O)OC.
What is the InChIKey of methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate?
The InChIKey is USPSCPBMLKAVAX-HCCKASOXSA-N. The full InChI is InChI=1S/C12H23NO4/c1-6-9(10(15)16-5)7-17-11(13-8-14)12(2,3)4/h8-9,11H,6-7H2,1-5H3,(H,13,14)/t9?,11-/m1/s1.
What are the key properties of methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate?
methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate has a molecular weight of 245.32 g/mol, XLogP of 1.32, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(1R)-1-formamido-2,2-dimethylpropoxy]methyl]butanoate is sourced from PubChem (CID 142807767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).