About N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine
N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine (PubChem CID 142808322) has the molecular formula C8H8N4S
and a molecular weight of 192.25 g/mol. Its IUPAC name is N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine.
Molecular Properties
| Compound Name | N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine |
| PubChem CID | 142808322 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine |
| SMILES | Cc1nc(NS)c2cnccc2n1 |
| InChI | InChI=1S/C8H8N4S/c1-5-10-7-2-3-9-4-6(7)8(11-5)12-13/h2-4,13H,1H3,(H,10,11,12) |
| InChIKey | UZNZAATZRZLEJK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine?
The IUPAC name of N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine (CID 142808322) is N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine.
What is the SMILES notation for N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine?
The canonical SMILES for N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine is Cc1nc(NS)c2cnccc2n1.
What is the InChIKey of N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine?
The InChIKey is UZNZAATZRZLEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S/c1-5-10-7-2-3-9-4-6(7)8(11-5)12-13/h2-4,13H,1H3,(H,10,11,12).
What are the key properties of N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine?
N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine has a molecular weight of 192.25 g/mol, XLogP of 1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpyrido[4,3-d]pyrimidin-4-yl)thiohydroxylamine is sourced from PubChem (CID 142808322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).