C11H17N3 — CID 142808467
N-[(1E,3Z)-2-[(2-methyl-4,5-dihydroimidazol-1-yl)methyl]penta-1,3-dienyl]methanimine (PubChem CID 142808467) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-[(1E,3Z)-2-[(2-methyl-4,5-dihydroimidazol-1-yl)methyl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-[(2-methyl-4,5-dihydroimidazol-1-yl)methyl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 142808467 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-[(1E,3Z)-2-[(2-methyl-4,5-dihydroimidazol-1-yl)methyl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)CN1CCN=C1C |
| InChI | InChI=1S/C11H17N3/c1-4-5-11(8-12-3)9-14-7-6-13-10(14)2/h4-5,8H,3,6-7,9H2,1-2H3/b5-4-,11-8+ |
| InChIKey | BSPLSQVYCNMCEI-LGXSBLIVSA-N |
| XLogP | 1.88 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|