C19H21N3O5 — CID 142808569
(2R,3S,4R)-2-(hydroxymethyl)-5-[(7S)-4-(4-methoxyphenyl)-7,8-dihydropyrido[3,2-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 142808569) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[(7S)-4-(4-methoxyphenyl)-7,8-dihydropyrido[3,2-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[(7S)-4-(4-methoxyphenyl)-7,8-dihydropyrido[3,2-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 142808569 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[(7S)-4-(4-methoxyphenyl)-7,8-dihydropyrido[3,2-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | COc1ccc(-c2ncnc3c2N=C[C@@H](C2O[C@H](CO)[C@@H](O)[C@H]2O)C3)cc1 |
| InChI | InChI=1S/C19H21N3O5/c1-26-12-4-2-10(3-5-12)15-16-13(21-9-22-15)6-11(7-20-16)19-18(25)17(24)14(8-23)27-19/h2-5,7,9,11,14,17-19,23-25H,6,8H2,1H3/t11-,14+,17+,18+,19?/m0/s1 |
| InChIKey | CNKPRMBUTPIRAD-HXQVDVHOSA-N |
| XLogP | 0.51 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |