About 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde
8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde (PubChem CID 142808605) has the molecular formula C21H29N7O2
and a molecular weight of 411.51 g/mol. Its IUPAC name is 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde.
Molecular Properties
| Compound Name | 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde |
| PubChem CID | 142808605 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde |
| SMILES | C=O.C=O.CC1CCC(n2c(NCCc3ccc(N)cc3)nc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C19H25N7.2CH2O/c1-12-2-7-15(10-12)26-18-16(17(21)23-11-24-18)25-19(26)22-9-8-13-3-5-14(20)6-4-13;2*1-2/h3-6,11-12,15H,2,7-10,20H2,1H3,(H,22,25)(H2,21,23,24);2*1H2 |
| InChIKey | YXLGOODTDPASOM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde?
The IUPAC name of 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde (CID 142808605) is 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde.
What is the SMILES notation for 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde?
The canonical SMILES for 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde is C=O.C=O.CC1CCC(n2c(NCCc3ccc(N)cc3)nc3c(N)ncnc32)C1.
What is the InChIKey of 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde?
The InChIKey is YXLGOODTDPASOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N7.2CH2O/c1-12-2-7-15(10-12)26-18-16(17(21)23-11-24-18)25-19(26)22-9-8-13-3-5-14(20)6-4-13;2*1-2/h3-6,11-12,15H,2,7-10,20H2,1H3,(H,22,25)(H2,21,23,24);2*1H2.
What are the key properties of 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde?
8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde has a molecular weight of 411.51 g/mol, XLogP of 2.64, 5 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-[2-(4-aminophenyl)ethyl]-9-(3-methylcyclopentyl)purine-6,8-diamine;formaldehyde is sourced from PubChem (CID 142808605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).