About 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium
1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium (PubChem CID 142808893) has the molecular formula C7H16ClFN2+2
and a molecular weight of 182.67 g/mol. Its IUPAC name is 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium.
Molecular Properties
| Compound Name | 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium |
| PubChem CID | 142808893 |
| Molecular Formula | C7H16ClFN2+2 |
| Molecular Weight | 182.67 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium |
| SMILES | CC[N+]1(CCl)CC[NH+](F)CC1 |
| InChI | InChI=1S/C7H15ClFN2/c1-2-11(7-8)5-3-10(9)4-6-11/h2-7H2,1H3/q+1/p+1 |
| InChIKey | ODODNDURVAMANA-UHFFFAOYSA-O |
| XLogP | -0.20 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.67 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium?
The IUPAC name of 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium (CID 142808893) is 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium.
What is the SMILES notation for 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium?
The canonical SMILES for 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium is CC[N+]1(CCl)CC[NH+](F)CC1.
What is the InChIKey of 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium?
The InChIKey is ODODNDURVAMANA-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H15ClFN2/c1-2-11(7-8)5-3-10(9)4-6-11/h2-7H2,1H3/q+1/p+1.
What are the key properties of 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium?
1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium has a molecular weight of 182.67 g/mol, XLogP of -0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-1-ethyl-4-fluoropiperazine-1,4-diium is sourced from PubChem (CID 142808893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).