C30H34N2O2 — CID 142809097
2-[1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]azepan-4-yl]-2,2-diphenylacetamide (PubChem CID 142809097) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is 2-[1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]azepan-4-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]azepan-4-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 142809097 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 2-[1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]azepan-4-yl]-2,2-diphenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)C1CCCN(CCc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C30H34N2O2/c31-29(33)30(25-8-3-1-4-9-25,26-10-5-2-6-11-26)27-12-7-18-32(20-16-27)19-15-23-13-14-28-24(22-23)17-21-34-28/h1-6,8-11,13-14,22,27H,7,12,15-21H2,(H2,31,33) |
| InChIKey | RYOMFCCBSKOTRG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |