About (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone
(2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone (PubChem CID 142809202) has the molecular formula C13H16F3NO
and a molecular weight of 259.27 g/mol. Its IUPAC name is (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone.
Molecular Properties
| Compound Name | (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone |
| PubChem CID | 142809202 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone |
| SMILES | CC1CCCN1C(=O)C1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H16F3NO/c1-9-4-3-7-17(9)12(18)10-5-2-6-11(8-10)13(14,15)16/h2,5-6,9-10H,3-4,7-8H2,1H3 |
| InChIKey | LGHSPOHHAKEUKT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone?
The IUPAC name of (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone (CID 142809202) is (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone.
What is the SMILES notation for (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone?
The canonical SMILES for (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone is CC1CCCN1C(=O)C1C=CC=C(C(F)(F)F)C1.
What is the InChIKey of (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone?
The InChIKey is LGHSPOHHAKEUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO/c1-9-4-3-7-17(9)12(18)10-5-2-6-11(8-10)13(14,15)16/h2,5-6,9-10H,3-4,7-8H2,1H3.
What are the key properties of (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone?
(2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone has a molecular weight of 259.27 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrrolidin-1-yl)-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanone is sourced from PubChem (CID 142809202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).