About 1,2-dimethylpyrrolidine;4-methylbenzaldehyde
1,2-dimethylpyrrolidine;4-methylbenzaldehyde (PubChem CID 142809260) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1,2-dimethylpyrrolidine;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | 1,2-dimethylpyrrolidine;4-methylbenzaldehyde |
| PubChem CID | 142809260 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1,2-dimethylpyrrolidine;4-methylbenzaldehyde |
| SMILES | CC1CCCN1C.Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C8H8O.C6H13N/c1-7-2-4-8(6-9)5-3-7;1-6-4-3-5-7(6)2/h2-6H,1H3;6H,3-5H2,1-2H3 |
| InChIKey | DRWBVVXBAJWVTA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpyrrolidine;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpyrrolidine;4-methylbenzaldehyde?
The IUPAC name of 1,2-dimethylpyrrolidine;4-methylbenzaldehyde (CID 142809260) is 1,2-dimethylpyrrolidine;4-methylbenzaldehyde.
What is the SMILES notation for 1,2-dimethylpyrrolidine;4-methylbenzaldehyde?
The canonical SMILES for 1,2-dimethylpyrrolidine;4-methylbenzaldehyde is CC1CCCN1C.Cc1ccc(C=O)cc1.
What is the InChIKey of 1,2-dimethylpyrrolidine;4-methylbenzaldehyde?
The InChIKey is DRWBVVXBAJWVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H13N/c1-7-2-4-8(6-9)5-3-7;1-6-4-3-5-7(6)2/h2-6H,1H3;6H,3-5H2,1-2H3.
What are the key properties of 1,2-dimethylpyrrolidine;4-methylbenzaldehyde?
1,2-dimethylpyrrolidine;4-methylbenzaldehyde has a molecular weight of 219.33 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpyrrolidine;4-methylbenzaldehyde is sourced from PubChem (CID 142809260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).