C18H22O4 — CID 142809355
ethane;3-[(2E,4E,6Z)-4-ethenylocta-2,4,6-trienoyl]-4-hydroxy-6-methylpyran-2-one (PubChem CID 142809355) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethane;3-[(2E,4E,6Z)-4-ethenylocta-2,4,6-trienoyl]-4-hydroxy-6-methylpyran-2-one.
| Compound Name | ethane;3-[(2E,4E,6Z)-4-ethenylocta-2,4,6-trienoyl]-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 142809355 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | ethane;3-[(2E,4E,6Z)-4-ethenylocta-2,4,6-trienoyl]-4-hydroxy-6-methylpyran-2-one |
| SMILES | C=CC(/C=C/C(=O)c1c(O)cc(C)oc1=O)=C\C=C/C.CC |
| InChI | InChI=1S/C16H16O4.C2H6/c1-4-6-7-12(5-2)8-9-13(17)15-14(18)10-11(3)20-16(15)19;1-2/h4-10,18H,2H2,1,3H3;1-2H3/b6-4-,9-8+,12-7+; |
| InChIKey | ANYCKBBHWBLJSX-FSYMZRRJSA-N |
| XLogP | 4.11 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|