C29H29F6N5O2S — CID 142809384
6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)-4-(2-methylphenyl)-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one (PubChem CID 142809384) has the molecular formula C29H29F6N5O2S and a molecular weight of 625.64 g/mol. Its IUPAC name is 6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)-4-(2-methylphenyl)-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one.
| Compound Name | 6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)-4-(2-methylphenyl)-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one |
|---|---|
| PubChem CID | 142809384 |
| Molecular Formula | C29H29F6N5O2S |
| Molecular Weight | 625.64 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)-4-(2-methylphenyl)-7,8,9,10-tetrahydropyrimido[4,5-b][1,5]diazocin-5-one |
| SMILES | C=S1(=O)CCN(c2nc3c(c(-c4ccccc4C)n2)C(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCN3)CC1 |
| InChI | InChI=1S/C29H29F6N5O2S/c1-18-6-3-4-7-22(18)24-23-25(38-27(37-24)39-10-12-43(2,42)13-11-39)36-8-5-9-40(26(23)41)17-19-14-20(28(30,31)32)16-21(15-19)29(33,34)35/h3-4,6-7,14-16H,2,5,8-13,17H2,1H3,(H,36,37,38) |
| InChIKey | MGCXEFIIXMEANR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|