C15H16N2O2S — CID 142809517
2-[2-amino-5-(2-methoxyphenyl)sulfanylphenyl]acetamide (PubChem CID 142809517) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[2-amino-5-(2-methoxyphenyl)sulfanylphenyl]acetamide.
| Compound Name | 2-[2-amino-5-(2-methoxyphenyl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 142809517 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[2-amino-5-(2-methoxyphenyl)sulfanylphenyl]acetamide |
| SMILES | COc1ccccc1Sc1ccc(N)c(CC(N)=O)c1 |
| InChI | InChI=1S/C15H16N2O2S/c1-19-13-4-2-3-5-14(13)20-11-6-7-12(16)10(8-11)9-15(17)18/h2-8H,9,16H2,1H3,(H2,17,18) |
| InChIKey | FLGPMWLJTSNKGH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|