C16H28FN — CID 142810005
1-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-N,N,4-trimethylcyclohexan-1-amine (PubChem CID 142810005) has the molecular formula C16H28FN and a molecular weight of 253.40 g/mol. Its IUPAC name is 1-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-N,N,4-trimethylcyclohexan-1-amine.
| Compound Name | 1-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-N,N,4-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142810005 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 1-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-N,N,4-trimethylcyclohexan-1-amine |
| SMILES | C/C(F)=C\C=C(/C)CC1(N(C)C)CCC(C)CC1 |
| InChI | InChI=1S/C16H28FN/c1-13-8-10-16(11-9-13,18(4)5)12-14(2)6-7-15(3)17/h6-7,13H,8-12H2,1-5H3/b14-6+,15-7+ |
| InChIKey | BITXBHZRIHPARJ-MKFXEVHTSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|