C18H31FO — CID 142810006
ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane (PubChem CID 142810006) has the molecular formula C18H31FO and a molecular weight of 282.44 g/mol. Its IUPAC name is ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane.
| Compound Name | ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane |
|---|---|
| PubChem CID | 142810006 |
| Molecular Formula | C18H31FO |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane |
| SMILES | CC.CC1CCC(Cc2ccccc2F)CC1.COC |
| InChI | InChI=1S/C14H19F.C2H6O.C2H6/c1-11-6-8-12(9-7-11)10-13-4-2-3-5-14(13)15;1-3-2;1-2/h2-5,11-12H,6-10H2,1H3;1-2H3;1-2H3 |
| InChIKey | BTIVIZGFZYLULF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |