About ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane
ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane (PubChem CID 142810006) has the molecular formula C18H31FO
and a molecular weight of 282.44 g/mol. Its IUPAC name is ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane.
Molecular Properties
| Compound Name | ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane |
| PubChem CID | 142810006 |
| Molecular Formula | C18H31FO |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane |
| SMILES | CC.CC1CCC(Cc2ccccc2F)CC1.COC |
| InChI | InChI=1S/C14H19F.C2H6O.C2H6/c1-11-6-8-12(9-7-11)10-13-4-2-3-5-14(13)15;1-3-2;1-2/h2-5,11-12H,6-10H2,1H3;1-2H3;1-2H3 |
| InChIKey | BTIVIZGFZYLULF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane?
The IUPAC name of ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane (CID 142810006) is ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane.
What is the SMILES notation for ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane?
The canonical SMILES for ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane is CC.CC1CCC(Cc2ccccc2F)CC1.COC.
What is the InChIKey of ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane?
The InChIKey is BTIVIZGFZYLULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F.C2H6O.C2H6/c1-11-6-8-12(9-7-11)10-13-4-2-3-5-14(13)15;1-3-2;1-2/h2-5,11-12H,6-10H2,1H3;1-2H3;1-2H3.
What are the key properties of ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane?
ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane has a molecular weight of 282.44 g/mol, XLogP of 5.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-2-[(4-methylcyclohexyl)methyl]benzene;methoxymethane is sourced from PubChem (CID 142810006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).